C33H51O4PSi2 — CID 146028799
tert-butyl-[[(4S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-diphenylphosphorylethylidene)-1-oxaspiro[2.5]octan-8-yl]oxy]-dimethylsilane (PubChem CID 146028799) has the molecular formula C33H51O4PSi2 and a molecular weight of 598.91 g/mol. Its IUPAC name is tert-butyl-[[(4S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-diphenylphosphorylethylidene)-1-oxaspiro[2.5]octan-8-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-diphenylphosphorylethylidene)-1-oxaspiro[2.5]octan-8-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 146028799 |
| Molecular Formula | C33H51O4PSi2 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | tert-butyl-[[(4S,8R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-diphenylphosphorylethylidene)-1-oxaspiro[2.5]octan-8-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C/C(=C\CP(=O)(c2ccccc2)c2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)C12CO2 |
| InChI | InChI=1S/C33H51O4PSi2/c1-31(2,3)39(7,8)36-29-23-26(24-30(33(29)25-35-33)37-40(9,10)32(4,5)6)21-22-38(34,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-21,29-30H,22-25H2,1-10H3/b26-21-/t29-,30+,33?/m1/s1 |
| InChIKey | DYGPQANLCDIKAM-JOFYVAJOSA-N |
| XLogP | 8.27 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|