About (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene
(2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene (PubChem CID 146028890) has the molecular formula C8H8S
and a molecular weight of 142.25 g/mol. Its IUPAC name is (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene.
Analyze (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene?
The IUPAC name of (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene (CID 146028890) is (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene.
What is the SMILES notation for (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene?
The canonical SMILES for (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene is [2H][C@]1([3H])Sc2ccccc2[C@@]1([2H])[3H].
What is the InChIKey of (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene?
The InChIKey is YJUFGFXVASPYFQ-CCVDMVTBSA-N. The full InChI is InChI=1S/C8H8S/c1-2-4-8-7(3-1)5-6-9-8/h1-4H,5-6H2/i5TD,6TD/t5-,6+/m0/s1.
What are the key properties of (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene?
(2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene has a molecular weight of 142.25 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-dideuterio-2,3-ditritio-1-benzothiophene is sourced from PubChem (CID 146028890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).