C25H33NO5SSi — CID 146029060
(6S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-phenyl-6-phenylperoxysulfanyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 146029060) has the molecular formula C25H33NO5SSi and a molecular weight of 487.69 g/mol. Its IUPAC name is (6S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-phenyl-6-phenylperoxysulfanyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (6S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-phenyl-6-phenylperoxysulfanyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 146029060 |
| Molecular Formula | C25H33NO5SSi |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (6S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3-phenyl-6-phenylperoxysulfanyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](SOOc2ccccc2)C(=O)N2C(c3ccccc3)CO[C@@]12C |
| InChI | InChI=1S/C25H33NO5SSi/c1-24(2,3)33(5,6)30-22-21(32-31-29-19-15-11-8-12-16-19)23(27)26-20(17-28-25(22,26)4)18-13-9-7-10-14-18/h7-16,20-22H,17H2,1-6H3/t20?,21-,22-,25-/m0/s1 |
| InChIKey | PBBIQKUFTJPVSO-NWXPOXQNSA-N |
| XLogP | 5.73 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|