C22H27FN6O9 — CID 146029982
(2R,3R)-2,3-dihydroxybutanedioic acid;[2-fluoro-3-(4-methyl-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methyl N-(diaminomethylidene)carbamate (PubChem CID 146029982) has the molecular formula C22H27FN6O9 and a molecular weight of 538.49 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;[2-fluoro-3-(4-methyl-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methyl N-(diaminomethylidene)carbamate.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;[2-fluoro-3-(4-methyl-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 146029982 |
| Molecular Formula | C22H27FN6O9 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;[2-fluoro-3-(4-methyl-2-morpholin-4-ylpyrimidin-5-yl)phenyl]methyl N-(diaminomethylidene)carbamate |
| SMILES | Cc1nc(N2CCOCC2)ncc1-c1cccc(COC(=O)N=C(N)N)c1F.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C18H21FN6O3.C4H6O6/c1-11-14(9-22-17(23-11)25-5-7-27-8-6-25)13-4-2-3-12(15(13)19)10-28-18(26)24-16(20)21;5-1(3(7)8)2(6)4(9)10/h2-4,9H,5-8,10H2,1H3,(H4,20,21,24,26);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | SVZQVNHQXRKSAJ-LREBCSMRSA-N |
| XLogP | -0.78 |
| TPSA | 244.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|