C15H17N3O3 — CID 146030162
acetylene;N-(diaminomethylidene)-2-(6-methyl-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide (PubChem CID 146030162) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is acetylene;N-(diaminomethylidene)-2-(6-methyl-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | acetylene;N-(diaminomethylidene)-2-(6-methyl-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 146030162 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | acetylene;N-(diaminomethylidene)-2-(6-methyl-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
| SMILES | C#C.Cc1cc2c(cc1C1CC1C(=O)N=C(N)N)OCO2 |
| InChI | InChI=1S/C13H15N3O3.C2H2/c1-6-2-10-11(19-5-18-10)4-7(6)8-3-9(8)12(17)16-13(14)15;1-2/h2,4,8-9H,3,5H2,1H3,(H4,14,15,16,17);1-2H |
| InChIKey | BWHUTFMVBYFOGU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|