C11H13F3N4O3S — CID 146031873
1-(diaminomethylidene)-3-[2-(3,3,3-trifluoropropyl)phenyl]sulfonylurea (PubChem CID 146031873) has the molecular formula C11H13F3N4O3S and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[2-(3,3,3-trifluoropropyl)phenyl]sulfonylurea.
| Compound Name | 1-(diaminomethylidene)-3-[2-(3,3,3-trifluoropropyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 146031873 |
| Molecular Formula | C11H13F3N4O3S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(diaminomethylidene)-3-[2-(3,3,3-trifluoropropyl)phenyl]sulfonylurea |
| SMILES | NC(N)=NC(=O)NS(=O)(=O)c1ccccc1CCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O3S/c12-11(13,14)6-5-7-3-1-2-4-8(7)22(20,21)18-10(19)17-9(15)16/h1-4H,5-6H2,(H5,15,16,17,18,19) |
| InChIKey | JWTNDJFRSJOTRB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|