C14H14N8O2S — CID 146032526
N-(diaminomethylidene)-4-methyl-2-[3-(2H-tetrazol-5-ylmethoxy)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 146032526) has the molecular formula C14H14N8O2S and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-methyl-2-[3-(2H-tetrazol-5-ylmethoxy)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-methyl-2-[3-(2H-tetrazol-5-ylmethoxy)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 146032526 |
| Molecular Formula | C14H14N8O2S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-(diaminomethylidene)-4-methyl-2-[3-(2H-tetrazol-5-ylmethoxy)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccc(OCc3nn[nH]n3)c2)sc1C(=O)N=C(N)N |
| InChI | InChI=1S/C14H14N8O2S/c1-7-11(12(23)18-14(15)16)25-13(17-7)8-3-2-4-9(5-8)24-6-10-19-21-22-20-10/h2-5H,6H2,1H3,(H4,15,16,18,23)(H,19,20,21,22) |
| InChIKey | CYVOWIPJBXJVAY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|