C21H24ClN5O4S — CID 146033216
10-chloro-N-(diaminomethylidene)-1-methyl-8-(4-methylpiperazin-1-yl)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 146033216) has the molecular formula C21H24ClN5O4S and a molecular weight of 477.97 g/mol. Its IUPAC name is 10-chloro-N-(diaminomethylidene)-1-methyl-8-(4-methylpiperazin-1-yl)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | 10-chloro-N-(diaminomethylidene)-1-methyl-8-(4-methylpiperazin-1-yl)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 146033216 |
| Molecular Formula | C21H24ClN5O4S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 10-chloro-N-(diaminomethylidene)-1-methyl-8-(4-methylpiperazin-1-yl)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N=C(N)N)cc2c1Oc1c(Cl)cc(N3CCN(C)CC3)cc1CS2(=O)=O |
| InChI | InChI=1S/C21H24ClN5O4S/c1-12-7-13(20(28)25-21(23)24)9-17-18(12)31-19-14(11-32(17,29)30)8-15(10-16(19)22)27-5-3-26(2)4-6-27/h7-10H,3-6,11H2,1-2H3,(H4,23,24,25,28) |
| InChIKey | PZUYIPAWOKVPRC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|