C20H23N3O3S — CID 146033407
N-(diaminomethylidene)-8-[2-(hydroxy-dimethyl-oxo-λ6-sulfanyl)phenyl]-5,6-dihydronaphthalene-2-carboxamide (PubChem CID 146033407) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(diaminomethylidene)-8-[2-(hydroxy-dimethyl-oxo-λ6-sulfanyl)phenyl]-5,6-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-8-[2-(hydroxy-dimethyl-oxo-λ6-sulfanyl)phenyl]-5,6-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 146033407 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(diaminomethylidene)-8-[2-(hydroxy-dimethyl-oxo-λ6-sulfanyl)phenyl]-5,6-dihydronaphthalene-2-carboxamide |
| SMILES | CS(C)(=O)(O)c1ccccc1C1=CCCc2ccc(C(=O)N=C(N)N)cc21 |
| InChI | InChI=1S/C20H23N3O3S/c1-27(2,25,26)18-9-4-3-7-16(18)15-8-5-6-13-10-11-14(12-17(13)15)19(24)23-20(21)22/h3-4,7-12H,5-6H2,1-2H3,(H,25,26)(H4,21,22,23,24) |
| InChIKey | JDLVMEQQUDUMSF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|