C12H15N3O4S — CID 146033966
N-(diaminomethylidene)-6-ethyl-2-methyl-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide (PubChem CID 146033966) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(diaminomethylidene)-6-ethyl-2-methyl-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide.
| Compound Name | N-(diaminomethylidene)-6-ethyl-2-methyl-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide |
|---|---|
| PubChem CID | 146033966 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(diaminomethylidene)-6-ethyl-2-methyl-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide |
| SMILES | CCc1cc2c(cc1C(=O)N=C(N)N)S(=O)(=O)C(C)O2 |
| InChI | InChI=1S/C12H15N3O4S/c1-3-7-4-9-10(20(17,18)6(2)19-9)5-8(7)11(16)15-12(13)14/h4-6H,3H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | KRRCEQOAIFDLAG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|