C27H24Cl2N6O3 — CID 146035890
N-[2-[[6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]pyrimidin-4-yl]amino]-3-methylphenyl]prop-2-enamide (PubChem CID 146035890) has the molecular formula C27H24Cl2N6O3 and a molecular weight of 551.43 g/mol. Its IUPAC name is N-[2-[[6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]pyrimidin-4-yl]amino]-3-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]pyrimidin-4-yl]amino]-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146035890 |
| Molecular Formula | C27H24Cl2N6O3 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | N-[2-[[6-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]pyrimidin-4-yl]amino]-3-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C)c1Nc1cc(-c2cccnc2Nc2c(Cl)c(OC)cc(OC)c2Cl)ncn1 |
| InChI | InChI=1S/C27H24Cl2N6O3/c1-5-22(36)33-17-10-6-8-15(2)25(17)34-21-12-18(31-14-32-21)16-9-7-11-30-27(16)35-26-23(28)19(37-3)13-20(38-4)24(26)29/h5-14H,1H2,2-4H3,(H,30,35)(H,33,36)(H,31,32,34) |
| InChIKey | ZQYUWUUBHKOFPC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|