About S-thiophen-2-yl N-cyclohexylcarbamothioate
S-thiophen-2-yl N-cyclohexylcarbamothioate (PubChem CID 146036114) has the molecular formula C11H15NOS2
and a molecular weight of 241.38 g/mol. Its IUPAC name is S-thiophen-2-yl N-cyclohexylcarbamothioate.
Molecular Properties
| Compound Name | S-thiophen-2-yl N-cyclohexylcarbamothioate |
| PubChem CID | 146036114 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | S-thiophen-2-yl N-cyclohexylcarbamothioate |
| SMILES | O=C(NC1CCCCC1)Sc1cccs1 |
| InChI | InChI=1S/C11H15NOS2/c13-11(15-10-7-4-8-14-10)12-9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2,(H,12,13) |
| InChIKey | ATEZQQVGFGKCFS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-thiophen-2-yl N-cyclohexylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-thiophen-2-yl N-cyclohexylcarbamothioate?
The IUPAC name of S-thiophen-2-yl N-cyclohexylcarbamothioate (CID 146036114) is S-thiophen-2-yl N-cyclohexylcarbamothioate.
What is the SMILES notation for S-thiophen-2-yl N-cyclohexylcarbamothioate?
The canonical SMILES for S-thiophen-2-yl N-cyclohexylcarbamothioate is O=C(NC1CCCCC1)Sc1cccs1.
What is the InChIKey of S-thiophen-2-yl N-cyclohexylcarbamothioate?
The InChIKey is ATEZQQVGFGKCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS2/c13-11(15-10-7-4-8-14-10)12-9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2,(H,12,13).
What are the key properties of S-thiophen-2-yl N-cyclohexylcarbamothioate?
S-thiophen-2-yl N-cyclohexylcarbamothioate has a molecular weight of 241.38 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-thiophen-2-yl N-cyclohexylcarbamothioate is sourced from PubChem (CID 146036114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).