C24H17N5S — CID 146036485
3-(4-methylphenyl)-10-phenyl-5-pyridin-3-yl-7-thia-1,3,4,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene (PubChem CID 146036485) has the molecular formula C24H17N5S and a molecular weight of 407.50 g/mol. Its IUPAC name is 3-(4-methylphenyl)-10-phenyl-5-pyridin-3-yl-7-thia-1,3,4,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene.
| Compound Name | 3-(4-methylphenyl)-10-phenyl-5-pyridin-3-yl-7-thia-1,3,4,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene |
|---|---|
| PubChem CID | 146036485 |
| Molecular Formula | C24H17N5S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-(4-methylphenyl)-10-phenyl-5-pyridin-3-yl-7-thia-1,3,4,9-tetrazatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene |
| SMILES | Cc1ccc(-n2nc(-c3cccnc3)c3sc4nc(-c5ccccc5)cn4c32)cc1 |
| InChI | InChI=1S/C24H17N5S/c1-16-9-11-19(12-10-16)29-23-22(21(27-29)18-8-5-13-25-14-18)30-24-26-20(15-28(23)24)17-6-3-2-4-7-17/h2-15H,1H3 |
| InChIKey | WDELVMZMXUKKSZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |