About (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide
(Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide (PubChem CID 146036673) has the molecular formula C31H31NO4Si
and a molecular weight of 509.68 g/mol. Its IUPAC name is (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide.
Molecular Properties
| Compound Name | (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide |
| PubChem CID | 146036673 |
| Molecular Formula | C31H31NO4Si |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide |
| SMILES | COC(CNC(=O)/C(=C/c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C31H31NO4Si/c1-34-30(35-2)24-32-31(33)29(23-25-15-7-3-8-16-25)36-37(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-23,30H,24H2,1-2H3,(H,32,33)/b29-23- |
| InChIKey | IXNHJXUURIGMOB-FAJYDZGRSA-N |
| XLogP | 3.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide?
The IUPAC name of (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide (CID 146036673) is (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide.
What is the SMILES notation for (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide?
The canonical SMILES for (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide is COC(CNC(=O)/C(=C/c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)OC.
What is the InChIKey of (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide?
The InChIKey is IXNHJXUURIGMOB-FAJYDZGRSA-N. The full InChI is InChI=1S/C31H31NO4Si/c1-34-30(35-2)24-32-31(33)29(23-25-15-7-3-8-16-25)36-37(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-23,30H,24H2,1-2H3,(H,32,33)/b29-23-.
What are the key properties of (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide?
(Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide has a molecular weight of 509.68 g/mol, XLogP of 3.45, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2,2-dimethoxyethyl)-3-phenyl-2-triphenylsilyloxyprop-2-enamide is sourced from PubChem (CID 146036673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).