C20H26N6O4 — CID 146037514
4-N-benzyl-2-N-cyclohexyl-1,3,5-triazine-2,4,6-triamine;(Z)-but-2-enedioic acid (PubChem CID 146037514) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is 4-N-benzyl-2-N-cyclohexyl-1,3,5-triazine-2,4,6-triamine;(Z)-but-2-enedioic acid.
| Compound Name | 4-N-benzyl-2-N-cyclohexyl-1,3,5-triazine-2,4,6-triamine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 146037514 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 4-N-benzyl-2-N-cyclohexyl-1,3,5-triazine-2,4,6-triamine;(Z)-but-2-enedioic acid |
| SMILES | Nc1nc(NCc2ccccc2)nc(NC2CCCCC2)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H22N6.C4H4O4/c17-14-20-15(18-11-12-7-3-1-4-8-12)22-16(21-14)19-13-9-5-2-6-10-13;5-3(6)1-2-4(7)8/h1,3-4,7-8,13H,2,5-6,9-11H2,(H4,17,18,19,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | XQNIFIPZDFWGHV-BTJKTKAUSA-N |
| XLogP | 2.52 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|