C13H14F6N2O3 — CID 146037528
bis(3,5-dimethyl-1,2-oxazole);1,1,1,3,3,3-hexafluoropropan-2-one (PubChem CID 146037528) has the molecular formula C13H14F6N2O3 and a molecular weight of 360.25 g/mol. Its IUPAC name is bis(3,5-dimethyl-1,2-oxazole);1,1,1,3,3,3-hexafluoropropan-2-one.
| Compound Name | bis(3,5-dimethyl-1,2-oxazole);1,1,1,3,3,3-hexafluoropropan-2-one |
|---|---|
| PubChem CID | 146037528 |
| Molecular Formula | C13H14F6N2O3 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | bis(3,5-dimethyl-1,2-oxazole);1,1,1,3,3,3-hexafluoropropan-2-one |
| SMILES | Cc1cc(C)on1.Cc1cc(C)on1.O=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C5H7NO.C3F6O/c2*1-4-3-5(2)7-6-4;4-2(5,6)1(10)3(7,8)9/h2*3H,1-2H3; |
| InChIKey | NEUVJQLMKHBOGC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |