C26H34N6O3 — CID 146037609
3-methoxy-4-[[(10R)-8-methyl-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]amino]-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 146037609) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-methoxy-4-[[(10R)-8-methyl-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]amino]-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 3-methoxy-4-[[(10R)-8-methyl-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]amino]-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 146037609 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 3-methoxy-4-[[(10R)-8-methyl-9-oxo-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-4-yl]amino]-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | COc1cc(C(=O)NC2CCN(C)CC2)ccc1Nc1ccc2c(n1)N1CCCC[C@@H]1C(=O)N2C |
| InChI | InChI=1S/C26H34N6O3/c1-30-14-11-18(12-15-30)27-25(33)17-7-8-19(22(16-17)35-3)28-23-10-9-20-24(29-23)32-13-5-4-6-21(32)26(34)31(20)2/h7-10,16,18,21H,4-6,11-15H2,1-3H3,(H,27,33)(H,28,29)/t21-/m1/s1 |
| InChIKey | AVGGLPRMVXANOV-OAQYLSRUSA-N |
| XLogP | 2.99 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |