About 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide
3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide (PubChem CID 146037816) has the molecular formula C20H18BrN3OS
and a molecular weight of 428.36 g/mol. Its IUPAC name is 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide.
Molecular Properties
| Compound Name | 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide |
| PubChem CID | 146037816 |
| Molecular Formula | C20H18BrN3OS |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide |
| SMILES | NC1=[N+](N=Cc2cc3ccccc3cc2O)CC(c2ccccc2)S1.[Br-] |
| InChI | InChI=1S/C20H17N3OS.BrH/c21-20-23(13-19(25-20)14-6-2-1-3-7-14)22-12-17-10-15-8-4-5-9-16(15)11-18(17)24;/h1-12,19,21H,13H2,(H,22,24);1H |
| InChIKey | ALAKIVDROIKILB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide?
The IUPAC name of 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide (CID 146037816) is 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide.
What is the SMILES notation for 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide?
The canonical SMILES for 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide is NC1=[N+](N=Cc2cc3ccccc3cc2O)CC(c2ccccc2)S1.[Br-].
What is the InChIKey of 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide?
The InChIKey is ALAKIVDROIKILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3OS.BrH/c21-20-23(13-19(25-20)14-6-2-1-3-7-14)22-12-17-10-15-8-4-5-9-16(15)11-18(17)24;/h1-12,19,21H,13H2,(H,22,24);1H.
What are the key properties of 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide?
3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide has a molecular weight of 428.36 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-amino-5-phenyl-4,5-dihydro-1,3-thiazol-3-ium-3-yl)iminomethyl]naphthalen-2-ol bromide is sourced from PubChem (CID 146037816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).