C17H24ClN5O — CID 146038340
1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(6-methoxy-3-pyridinyl)piperazine (PubChem CID 146038340) has the molecular formula C17H24ClN5O and a molecular weight of 349.87 g/mol. Its IUPAC name is 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(6-methoxy-3-pyridinyl)piperazine.
| Compound Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(6-methoxy-3-pyridinyl)piperazine |
|---|---|
| PubChem CID | 146038340 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[(5-chloro-3-ethyl-1-methylpyrazol-4-yl)methyl]-4-(6-methoxy-3-pyridinyl)piperazine |
| SMILES | CCc1nn(C)c(Cl)c1CN1CCN(c2ccc(OC)nc2)CC1 |
| InChI | InChI=1S/C17H24ClN5O/c1-4-15-14(17(18)21(2)20-15)12-22-7-9-23(10-8-22)13-5-6-16(24-3)19-11-13/h5-6,11H,4,7-10,12H2,1-3H3 |
| InChIKey | OUQJMZOXISTUDO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |