About 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine]
6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] (PubChem CID 146038961) has the molecular formula C22H25N5O2
and a molecular weight of 391.48 g/mol. Its IUPAC name is 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine].
Molecular Properties
| Compound Name | 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] |
| PubChem CID | 146038961 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] |
| SMILES | c1cnc(N2CCC3(CC2)OCCc2cc(OCCn4ccnc4)ccc23)cn1 |
| InChI | InChI=1S/C22H25N5O2/c1-2-20-18(15-19(1)28-14-12-26-11-8-24-17-26)3-13-29-22(20)4-9-27(10-5-22)21-16-23-6-7-25-21/h1-2,6-8,11,15-17H,3-5,9-10,12-14H2 |
| InChIKey | SNIIMKSENUSTFJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine]?
The IUPAC name of 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] (CID 146038961) is 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine].
What is the SMILES notation for 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine]?
The canonical SMILES for 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] is c1cnc(N2CCC3(CC2)OCCc2cc(OCCn4ccnc4)ccc23)cn1.
What is the InChIKey of 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine]?
The InChIKey is SNIIMKSENUSTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O2/c1-2-20-18(15-19(1)28-14-12-26-11-8-24-17-26)3-13-29-22(20)4-9-27(10-5-22)21-16-23-6-7-25-21/h1-2,6-8,11,15-17H,3-5,9-10,12-14H2.
What are the key properties of 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine]?
6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] has a molecular weight of 391.48 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-imidazol-1-ylethoxy)-1'-pyrazin-2-ylspiro[3,4-dihydroisochromene-1,4'-piperidine] is sourced from PubChem (CID 146038961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).