C17H22N4O — CID 146039078
(3S,4S)-4-piperidin-1-yl-1-quinoxalin-2-ylpyrrolidin-3-ol (PubChem CID 146039078) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is (3S,4S)-4-piperidin-1-yl-1-quinoxalin-2-ylpyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-piperidin-1-yl-1-quinoxalin-2-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 146039078 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3S,4S)-4-piperidin-1-yl-1-quinoxalin-2-ylpyrrolidin-3-ol |
| SMILES | O[C@H]1CN(c2cnc3ccccc3n2)C[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C17H22N4O/c22-16-12-21(11-15(16)20-8-4-1-5-9-20)17-10-18-13-6-2-3-7-14(13)19-17/h2-3,6-7,10,15-16,22H,1,4-5,8-9,11-12H2/t15-,16-/m0/s1 |
| InChIKey | HOUHATXLIPXRFY-HOTGVXAUSA-N |
| XLogP | 1.67 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |