C15H17N5O3 — CID 146039102
methyl 6-amino-2-(2-pyridin-3-ylmorpholin-4-yl)pyrimidine-4-carboxylate (PubChem CID 146039102) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl 6-amino-2-(2-pyridin-3-ylmorpholin-4-yl)pyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-2-(2-pyridin-3-ylmorpholin-4-yl)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 146039102 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl 6-amino-2-(2-pyridin-3-ylmorpholin-4-yl)pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(N)nc(N2CCOC(c3cccnc3)C2)n1 |
| InChI | InChI=1S/C15H17N5O3/c1-22-14(21)11-7-13(16)19-15(18-11)20-5-6-23-12(9-20)10-3-2-4-17-8-10/h2-4,7-8,12H,5-6,9H2,1H3,(H2,16,18,19) |
| InChIKey | GBHXBGWITBBKAO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |