C11H13F3N6 — CID 146039306
6-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 146039306) has the molecular formula C11H13F3N6 and a molecular weight of 286.26 g/mol. Its IUPAC name is 6-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 146039306 |
| Molecular Formula | C11H13F3N6 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 6-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1nc(C2CCc3ncnn3C2)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H13F3N6/c1-7-17-10(20(18-7)5-11(12,13)14)8-2-3-9-15-6-16-19(9)4-8/h6,8H,2-5H2,1H3 |
| InChIKey | FUJAWKKFCIJFJX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |