C17H26N4O — CID 146039380
5-[2-(2-ethoxyethyl)-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-2,4-dimethylpyridine (PubChem CID 146039380) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-[2-(2-ethoxyethyl)-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-2,4-dimethylpyridine.
| Compound Name | 5-[2-(2-ethoxyethyl)-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-2,4-dimethylpyridine |
|---|---|
| PubChem CID | 146039380 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 5-[2-(2-ethoxyethyl)-5-(2-methylpropyl)-1,2,4-triazol-3-yl]-2,4-dimethylpyridine |
| SMILES | CCOCCn1nc(CC(C)C)nc1-c1cnc(C)cc1C |
| InChI | InChI=1S/C17H26N4O/c1-6-22-8-7-21-17(19-16(20-21)9-12(2)3)15-11-18-14(5)10-13(15)4/h10-12H,6-9H2,1-5H3 |
| InChIKey | SOHWNZGIYXKUDH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|