C18H19N3O — CID 146039990
2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-methylquinoline-3-carbonitrile (PubChem CID 146039990) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-methylquinoline-3-carbonitrile.
| Compound Name | 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 146039990 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-4-methylquinoline-3-carbonitrile |
| SMILES | Cc1c(C#N)c(N2C[C@H]3CC(O)C[C@H]3C2)nc2ccccc12 |
| InChI | InChI=1S/C18H19N3O/c1-11-15-4-2-3-5-17(15)20-18(16(11)8-19)21-9-12-6-14(22)7-13(12)10-21/h2-5,12-14,22H,6-7,9-10H2,1H3/t12-,13+,14? |
| InChIKey | UZWZUMXEBLCHHP-PBWFPOADSA-N |
| XLogP | 2.62 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |