C20H21N5O2 — CID 146040565
2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-4-methylquinoline-3-carbonitrile (PubChem CID 146040565) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-4-methylquinoline-3-carbonitrile.
| Compound Name | 2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-4-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 146040565 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-4-methylquinoline-3-carbonitrile |
| SMILES | Cc1c(C#N)c(N2CCC3(CC2)C(=O)N(C)C(=O)N3C)nc2ccccc12 |
| InChI | InChI=1S/C20H21N5O2/c1-13-14-6-4-5-7-16(14)22-17(15(13)12-21)25-10-8-20(9-11-25)18(26)23(2)19(27)24(20)3/h4-7H,8-11H2,1-3H3 |
| InChIKey | DFUXMHKHHRVVBS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|