C23H35NO7 — CID 14604063
8-ethyl-13,15,19-trimethoxy-5-oxa-8-azaheptacyclo[8.7.2.114,17.01,9.04,6.06,18.011,16]icosane-2,10,11-triol (PubChem CID 14604063) has the molecular formula C23H35NO7 and a molecular weight of 437.53 g/mol. Its IUPAC name is 8-ethyl-13,15,19-trimethoxy-5-oxa-8-azaheptacyclo[8.7.2.114,17.01,9.04,6.06,18.011,16]icosane-2,10,11-triol.
| Compound Name | 8-ethyl-13,15,19-trimethoxy-5-oxa-8-azaheptacyclo[8.7.2.114,17.01,9.04,6.06,18.011,16]icosane-2,10,11-triol |
|---|---|
| PubChem CID | 14604063 |
| Molecular Formula | C23H35NO7 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 8-ethyl-13,15,19-trimethoxy-5-oxa-8-azaheptacyclo[8.7.2.114,17.01,9.04,6.06,18.011,16]icosane-2,10,11-triol |
| SMILES | CCN1CC23OC2CC(O)C24C5CC6C(OC)CC(O)(C5C6OC)C(O)(C(OC)C32)C14 |
| InChI | InChI=1S/C23H35NO7/c1-5-24-9-20-14(31-20)7-13(25)22-11-6-10-12(28-2)8-21(26,15(11)16(10)29-3)23(27,19(22)24)18(30-4)17(20)22/h10-19,25-27H,5-9H2,1-4H3 |
| InChIKey | ONTOCCOJNQFNKI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|