C22H21N3O — CID 146040945
2-[3-hydroxy-3-(2-methylphenyl)pyrrolidin-1-yl]-4-methylquinoline-3-carbonitrile (PubChem CID 146040945) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[3-hydroxy-3-(2-methylphenyl)pyrrolidin-1-yl]-4-methylquinoline-3-carbonitrile.
| Compound Name | 2-[3-hydroxy-3-(2-methylphenyl)pyrrolidin-1-yl]-4-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 146040945 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-[3-hydroxy-3-(2-methylphenyl)pyrrolidin-1-yl]-4-methylquinoline-3-carbonitrile |
| SMILES | Cc1ccccc1C1(O)CCN(c2nc3ccccc3c(C)c2C#N)C1 |
| InChI | InChI=1S/C22H21N3O/c1-15-7-3-5-9-19(15)22(26)11-12-25(14-22)21-18(13-23)16(2)17-8-4-6-10-20(17)24-21/h3-10,26H,11-12,14H2,1-2H3 |
| InChIKey | BJQXXUQMZGVZJE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |