C15H22FN3O3S — CID 146042229
N-[(1S,3R)-3-(dimethylsulfamoylamino)cyclopentyl]-2-fluoro-4-methylbenzamide (PubChem CID 146042229) has the molecular formula C15H22FN3O3S and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[(1S,3R)-3-(dimethylsulfamoylamino)cyclopentyl]-2-fluoro-4-methylbenzamide.
| Compound Name | N-[(1S,3R)-3-(dimethylsulfamoylamino)cyclopentyl]-2-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 146042229 |
| Molecular Formula | C15H22FN3O3S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[(1S,3R)-3-(dimethylsulfamoylamino)cyclopentyl]-2-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CC[C@@H](NS(=O)(=O)N(C)C)C2)c(F)c1 |
| InChI | InChI=1S/C15H22FN3O3S/c1-10-4-7-13(14(16)8-10)15(20)17-11-5-6-12(9-11)18-23(21,22)19(2)3/h4,7-8,11-12,18H,5-6,9H2,1-3H3,(H,17,20)/t11-,12+/m0/s1 |
| InChIKey | PPXUPZCZRLWIGA-NWDGAFQWSA-N |
| XLogP | 1.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |