C15H20F3N5 — CID 146042624
5-[5-(2-methylpropyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 146042624) has the molecular formula C15H20F3N5 and a molecular weight of 327.35 g/mol. Its IUPAC name is 5-[5-(2-methylpropyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 5-[5-(2-methylpropyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 146042624 |
| Molecular Formula | C15H20F3N5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 5-[5-(2-methylpropyl)-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | CC(C)Cc1nc(C2CCn3nccc3C2)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C15H20F3N5/c1-10(2)7-13-20-14(23(21-13)9-15(16,17)18)11-4-6-22-12(8-11)3-5-19-22/h3,5,10-11H,4,6-9H2,1-2H3 |
| InChIKey | IDTVWEZOTUMWLL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |