C13H19N3 — CID 146043207
(3aS,6aR)-2-(4,5-dimethylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 146043207) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (3aS,6aR)-2-(4,5-dimethylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-2-(4,5-dimethylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 146043207 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (3aS,6aR)-2-(4,5-dimethylpyridazin-3-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Cc1cnnc(N2C[C@H]3CCC[C@H]3C2)c1C |
| InChI | InChI=1S/C13H19N3/c1-9-6-14-15-13(10(9)2)16-7-11-4-3-5-12(11)8-16/h6,11-12H,3-5,7-8H2,1-2H3/t11-,12+ |
| InChIKey | YPTFCARZGWQHGU-TXEJJXNPSA-N |
| XLogP | 2.33 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |