C15H21N5O4S — CID 146043523
2-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 146043523) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 2-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 146043523 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CN1CCn2nc(C(=O)N3CCN(C)[C@@H]4CS(=O)(=O)C[C@@H]43)cc2C1=O |
| InChI | InChI=1S/C15H21N5O4S/c1-17-3-5-19(13-9-25(23,24)8-12(13)17)14(21)10-7-11-15(22)18(2)4-6-20(11)16-10/h7,12-13H,3-6,8-9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | NCHITGKRHYKYRU-OLZOCXBDSA-N |
| XLogP | -1.48 |
| TPSA | 95.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |