C23H22N2O4 — CID 146043871
(3aS,6aS)-5-(5-ethoxy-2-phenyl-1-benzofuran-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one (PubChem CID 146043871) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (3aS,6aS)-5-(5-ethoxy-2-phenyl-1-benzofuran-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-5-(5-ethoxy-2-phenyl-1-benzofuran-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 146043871 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (3aS,6aS)-5-(5-ethoxy-2-phenyl-1-benzofuran-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
| SMILES | CCOc1ccc2oc(-c3ccccc3)c(C(=O)N3C[C@@H]4CC(=O)N[C@@H]4C3)c2c1 |
| InChI | InChI=1S/C23H22N2O4/c1-2-28-16-8-9-19-17(11-16)21(22(29-19)14-6-4-3-5-7-14)23(27)25-12-15-10-20(26)24-18(15)13-25/h3-9,11,15,18H,2,10,12-13H2,1H3,(H,24,26)/t15-,18+/m0/s1 |
| InChIKey | KDBQWTSGCOQPJB-MAUKXSAKSA-N |
| XLogP | 3.46 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |