C21H27N5O — CID 146044137
(2-amino-4-phenylpyrimidin-5-yl)-(4-piperidin-4-ylpiperidin-1-yl)methanone (PubChem CID 146044137) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (2-amino-4-phenylpyrimidin-5-yl)-(4-piperidin-4-ylpiperidin-1-yl)methanone.
| Compound Name | (2-amino-4-phenylpyrimidin-5-yl)-(4-piperidin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 146044137 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (2-amino-4-phenylpyrimidin-5-yl)-(4-piperidin-4-ylpiperidin-1-yl)methanone |
| SMILES | Nc1ncc(C(=O)N2CCC(C3CCNCC3)CC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H27N5O/c22-21-24-14-18(19(25-21)17-4-2-1-3-5-17)20(27)26-12-8-16(9-13-26)15-6-10-23-11-7-15/h1-5,14-16,23H,6-13H2,(H2,22,24,25) |
| InChIKey | XDNNOZNLHPOKRH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |