C13H13F3N2O4S — CID 146045890
(3aS,6aS)-5-[4-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one (PubChem CID 146045890) has the molecular formula C13H13F3N2O4S and a molecular weight of 350.32 g/mol. Its IUPAC name is (3aS,6aS)-5-[4-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-5-[4-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 146045890 |
| Molecular Formula | C13H13F3N2O4S |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (3aS,6aS)-5-[4-(trifluoromethoxy)phenyl]sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
| SMILES | O=C1C[C@H]2CN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)C[C@H]2N1 |
| InChI | InChI=1S/C13H13F3N2O4S/c14-13(15,16)22-9-1-3-10(4-2-9)23(20,21)18-6-8-5-12(19)17-11(8)7-18/h1-4,8,11H,5-7H2,(H,17,19)/t8-,11+/m0/s1 |
| InChIKey | DPXGZQJJXGKCCU-GZMMTYOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |