C22H26N6 — CID 146046242
5-ethyl-2-[1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]imidazol-2-yl]pyridine (PubChem CID 146046242) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-ethyl-2-[1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]imidazol-2-yl]pyridine.
| Compound Name | 5-ethyl-2-[1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 146046242 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 5-ethyl-2-[1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]imidazol-2-yl]pyridine |
| SMILES | CCc1ccc(-c2nccn2C23CC4CC(CC(n5cncn5)(C4)C2)C3)nc1 |
| InChI | InChI=1S/C22H26N6/c1-2-16-3-4-19(25-12-16)20-24-5-6-27(20)21-8-17-7-18(9-21)11-22(10-17,13-21)28-15-23-14-26-28/h3-6,12,14-15,17-18H,2,7-11,13H2,1H3 |
| InChIKey | ORKMBTPUXMKROS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |