C19H20N4O — CID 146046335
(3R,5S)-5-amino-1-(2-phenylquinazolin-4-yl)piperidin-3-ol (PubChem CID 146046335) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is (3R,5S)-5-amino-1-(2-phenylquinazolin-4-yl)piperidin-3-ol.
| Compound Name | (3R,5S)-5-amino-1-(2-phenylquinazolin-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 146046335 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (3R,5S)-5-amino-1-(2-phenylquinazolin-4-yl)piperidin-3-ol |
| SMILES | N[C@H]1C[C@@H](O)CN(c2nc(-c3ccccc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C19H20N4O/c20-14-10-15(24)12-23(11-14)19-16-8-4-5-9-17(16)21-18(22-19)13-6-2-1-3-7-13/h1-9,14-15,24H,10-12,20H2/t14-,15+/m0/s1 |
| InChIKey | LHDZDNDKXBSNNS-LSDHHAIUSA-N |
| XLogP | 2.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |