C15H15N5O4S — CID 1460465
N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 1460465) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 1460465 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N'-[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)c2ccco2)nnc1-c1ccco1 |
| InChI | InChI=1S/C15H15N5O4S/c1-2-20-13(10-5-3-7-23-10)17-19-15(20)25-9-12(21)16-18-14(22)11-6-4-8-24-11/h3-8H,2,9H2,1H3,(H,16,21)(H,18,22) |
| InChIKey | IOHAZXNQEYUTDU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|