C22H31N5O2 — CID 146046744
(1-methylpiperidin-3-yl)-[(1R,2S,6R,7S)-10-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methanone (PubChem CID 146046744) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl)-[(1R,2S,6R,7S)-10-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methanone.
| Compound Name | (1-methylpiperidin-3-yl)-[(1R,2S,6R,7S)-10-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methanone |
|---|---|
| PubChem CID | 146046744 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | (1-methylpiperidin-3-yl)-[(1R,2S,6R,7S)-10-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methanone |
| SMILES | CN1CCCC(C(=O)N2C[C@@H]3[C@H](C2)[C@@H]2CC[C@H]3N2C(=O)c2n[nH]c3c2CCC3)C1 |
| InChI | InChI=1S/C22H31N5O2/c1-25-9-3-4-13(10-25)21(28)26-11-15-16(12-26)19-8-7-18(15)27(19)22(29)20-14-5-2-6-17(14)23-24-20/h13,15-16,18-19H,2-12H2,1H3,(H,23,24)/t13?,15-,16+,18-,19+ |
| InChIKey | MPLVGNIUMNAWCO-LYJDAWSMSA-N |
| XLogP | 1.30 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |