C22H27F3N6O3 — CID 146047314
4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047314) has the molecular formula C22H27F3N6O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is 4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047314 |
| Molecular Formula | C22H27F3N6O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COCc1ccc(NC2CC(Nc3cccc(C(F)(F)F)n3)NC3NN(C)C(=O)C23)c(OC)c1 |
| InChI | InChI=1S/C22H27F3N6O3/c1-31-21(32)19-14(26-13-8-7-12(11-33-2)9-15(13)34-3)10-18(29-20(19)30-31)28-17-6-4-5-16(27-17)22(23,24)25/h4-9,14,18-20,26,29-30H,10-11H2,1-3H3,(H,27,28) |
| InChIKey | XTLWTZFJYLSSNP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |