C24H32FN7O2 — CID 146047324
4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047324) has the molecular formula C24H32FN7O2 and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047324 |
| Molecular Formula | C24H32FN7O2 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(F)cccc1NC1CC(Nc2ccc(N3CCCCC3)cn2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C24H32FN7O2/c1-31-24(33)21-18(27-17-8-6-7-16(25)22(17)34-2)13-20(29-23(21)30-31)28-19-10-9-15(14-26-19)32-11-4-3-5-12-32/h6-10,14,18,20-21,23,27,29-30H,3-5,11-13H2,1-2H3,(H,26,28) |
| InChIKey | XTAFXKMOVCYGNU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |