C18H24FN7O2 — CID 146047325
4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047325) has the molecular formula C18H24FN7O2 and a molecular weight of 389.44 g/mol. Its IUPAC name is 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047325 |
| Molecular Formula | C18H24FN7O2 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[(1-methylpyrazol-3-yl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(F)cccc1NC1CC(Nc2ccn(C)n2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C18H24FN7O2/c1-25-8-7-13(23-25)21-14-9-12(15-17(22-14)24-26(2)18(15)27)20-11-6-4-5-10(19)16(11)28-3/h4-8,12,14-15,17,20,22,24H,9H2,1-3H3,(H,21,23) |
| InChIKey | ZSFDZQVPDFOFME-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |