C20H22F4N6O2 — CID 146047333
4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047333) has the molecular formula C20H22F4N6O2 and a molecular weight of 454.43 g/mol. Its IUPAC name is 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047333 |
| Molecular Formula | C20H22F4N6O2 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-(3-fluoro-2-methoxyanilino)-2-methyl-6-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | COc1c(F)cccc1NC1CC(Nc2cccc(C(F)(F)F)n2)NC2NN(C)C(=O)C12 |
| InChI | InChI=1S/C20H22F4N6O2/c1-30-19(31)16-12(25-11-6-3-5-10(21)17(11)32-2)9-15(28-18(16)29-30)27-14-8-4-7-13(26-14)20(22,23)24/h3-8,12,15-16,18,25,28-29H,9H2,1-2H3,(H,26,27) |
| InChIKey | JKKVZUWGSBXIOZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |