C24H33N7O3S — CID 146047364
2-methyl-4-(2-methylsulfonylanilino)-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047364) has the molecular formula C24H33N7O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is 2-methyl-4-(2-methylsulfonylanilino)-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 2-methyl-4-(2-methylsulfonylanilino)-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047364 |
| Molecular Formula | C24H33N7O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 2-methyl-4-(2-methylsulfonylanilino)-6-[(5-piperidin-1-yl-2-pyridinyl)amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | CN1NC2NC(Nc3ccc(N4CCCCC4)cn3)CC(Nc3ccccc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C24H33N7O3S/c1-30-24(32)22-18(26-17-8-4-5-9-19(17)35(2,33)34)14-21(28-23(22)29-30)27-20-11-10-16(15-25-20)31-12-6-3-7-13-31/h4-5,8-11,15,18,21-23,26,28-29H,3,6-7,12-14H2,1-2H3,(H,25,27) |
| InChIKey | VHTQNVGEKGWOPQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |