C19H22N8O3S — CID 146047365
6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile (PubChem CID 146047365) has the molecular formula C19H22N8O3S and a molecular weight of 442.51 g/mol. Its IUPAC name is 6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 146047365 |
| Molecular Formula | C19H22N8O3S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyrazine-2-carbonitrile |
| SMILES | CN1NC2NC(Nc3cncc(C#N)n3)CC(Nc3ccccc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C19H22N8O3S/c1-27-19(28)17-13(23-12-5-3-4-6-14(12)31(2,29)30)7-15(25-18(17)26-27)24-16-10-21-9-11(8-20)22-16/h3-6,9-10,13,15,17-18,23,25-26H,7H2,1-2H3,(H,22,24) |
| InChIKey | BZQISRFNVTYXPS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |