C20H23N7O3S — CID 146047385
6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 146047385) has the molecular formula C20H23N7O3S and a molecular weight of 441.52 g/mol. Its IUPAC name is 6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146047385 |
| Molecular Formula | C20H23N7O3S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 6-[[2-methyl-4-(2-methylsulfonylanilino)-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | CN1NC2NC(Nc3ccc(C#N)cn3)CC(Nc3ccccc3S(C)(=O)=O)C2C1=O |
| InChI | InChI=1S/C20H23N7O3S/c1-27-20(28)18-14(23-13-5-3-4-6-15(13)31(2,29)30)9-17(25-19(18)26-27)24-16-8-7-12(10-21)11-22-16/h3-8,11,14,17-19,23,25-26H,9H2,1-2H3,(H,22,24) |
| InChIKey | REAIWPNORQJORU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |