C21H24ClF3N6O3S — CID 146047411
4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[5-methyl-6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 146047411) has the molecular formula C21H24ClF3N6O3S and a molecular weight of 532.98 g/mol. Its IUPAC name is 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[5-methyl-6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[5-methyl-6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 146047411 |
| Molecular Formula | C21H24ClF3N6O3S |
| Molecular Weight | 532.98 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 4-(4-chloro-2-methylsulfonylanilino)-2-methyl-6-[[5-methyl-6-(trifluoromethyl)-2-pyridinyl]amino]-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cc1ccc(NC2CC(Nc3ccc(Cl)cc3S(C)(=O)=O)C3C(=O)N(C)NC3N2)nc1C(F)(F)F |
| InChI | InChI=1S/C21H24ClF3N6O3S/c1-10-4-7-15(28-18(10)21(23,24)25)27-16-9-13(17-19(29-16)30-31(2)20(17)32)26-12-6-5-11(22)8-14(12)35(3,33)34/h4-8,13,16-17,19,26,29-30H,9H2,1-3H3,(H,27,28) |
| InChIKey | BWMCDAHTSSDDKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.98 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |