About (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate
(3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate (PubChem CID 146047758) has the molecular formula C29H28NO3-
and a molecular weight of 438.55 g/mol. Its IUPAC name is (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate.
Molecular Properties
| Compound Name | (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate |
| PubChem CID | 146047758 |
| Molecular Formula | C29H28NO3- |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)[O-])c1ccc(OCc2ccc(CN3CCCc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C29H29NO3/c1-2-6-26(19-29(31)32)24-14-16-27(17-15-24)33-21-23-12-10-22(11-13-23)20-30-18-5-8-25-7-3-4-9-28(25)30/h3-4,7,9-17,26H,5,8,18-21H2,1H3,(H,31,32)/p-1/t26-/m0/s1 |
| InChIKey | UKTCIYBBXKMNLM-SANMLTNESA-M |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate?
The IUPAC name of (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate (CID 146047758) is (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate.
What is the SMILES notation for (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate?
The canonical SMILES for (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate is CC#C[C@@H](CC(=O)[O-])c1ccc(OCc2ccc(CN3CCCc4ccccc43)cc2)cc1.
What is the InChIKey of (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate?
The InChIKey is UKTCIYBBXKMNLM-SANMLTNESA-M. The full InChI is InChI=1S/C29H29NO3/c1-2-6-26(19-29(31)32)24-14-16-27(17-15-24)33-21-23-12-10-22(11-13-23)20-30-18-5-8-25-7-3-4-9-28(25)30/h3-4,7,9-17,26H,5,8,18-21H2,1H3,(H,31,32)/p-1/t26-/m0/s1.
What are the key properties of (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate?
(3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate has a molecular weight of 438.55 g/mol, XLogP of 4.47, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[4-[[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoate is sourced from PubChem (CID 146047758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).