C34H38FN9O4 — CID 146047860
N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide (PubChem CID 146047860) has the molecular formula C34H38FN9O4 and a molecular weight of 655.74 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 146047860 |
| Molecular Formula | C34H38FN9O4 |
| Molecular Weight | 655.74 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-fluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide |
| SMILES | CC(C)N1CC(C(=O)Nc2ccc(-c3cc(C4CCN(C(=O)N(C)C)CC4)n4ncnc(N)c34)cc2)C(=O)N(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C34H38FN9O4/c1-20(2)42-18-27(32(46)43(34(42)48)25-7-5-6-23(35)16-25)31(45)39-24-10-8-21(9-11-24)26-17-28(44-29(26)30(36)37-19-38-44)22-12-14-41(15-13-22)33(47)40(3)4/h5-11,16-17,19-20,22,27H,12-15,18H2,1-4H3,(H,39,45)(H2,36,37,38) |
| InChIKey | QWVZJTYLRRGEBC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|