C35H38F2N8O4 — CID 146047865
N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide (PubChem CID 146047865) has the molecular formula C35H38F2N8O4 and a molecular weight of 672.74 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 146047865 |
| Molecular Formula | C35H38F2N8O4 |
| Molecular Weight | 672.74 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-yl-1,3-diazinane-5-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(c2cc(-c3ccc(NC(=O)C4CN(C(C)C)C(=O)N(c5cc(F)ccc5F)C4=O)cc3)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C35H38F2N8O4/c1-19(2)33(47)42-13-11-22(12-14-42)28-16-25(30-31(38)39-18-40-45(28)30)21-5-8-24(9-6-21)41-32(46)26-17-43(20(3)4)35(49)44(34(26)48)29-15-23(36)7-10-27(29)37/h5-10,15-16,18-20,22,26H,11-14,17H2,1-4H3,(H,41,46)(H2,38,39,40) |
| InChIKey | ALBARBXDPNKPCS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 146.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.74 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|